C14H11Cl2F3N2O4 — CID 168557995
3-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557995) has the molecular formula C14H11Cl2F3N2O4 and a molecular weight of 399.15 g/mol. Its IUPAC name is 3-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557995 |
| Molecular Formula | C14H11Cl2F3N2O4 |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 3-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(Cl)c(OC(F)(F)C(F)Cl)c2)C(=O)N1CCO |
| InChI | InChI=1S/C14H11Cl2F3N2O4/c15-8-2-1-7(5-10(8)25-14(18,19)13(16)17)20-9-6-11(23)21(3-4-22)12(9)24/h1-2,5-6,13,20,22H,3-4H2 |
| InChIKey | ZHBROXDEEGIMOW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|