C13H12ClN3O4 — CID 168556316
2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzamide (PubChem CID 168556316) has the molecular formula C13H12ClN3O4 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzamide.
| Compound Name | 2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 168556316 |
| Molecular Formula | C13H12ClN3O4 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC2=CC(=O)N(CCO)C2=O)cc1Cl |
| InChI | InChI=1S/C13H12ClN3O4/c14-9-5-7(1-2-8(9)12(15)20)16-10-6-11(19)17(3-4-18)13(10)21/h1-2,5-6,16,18H,3-4H2,(H2,15,20) |
| InChIKey | QBPYBCQPRJTVLT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|