C16H15ClN4O3 — CID 168559648
3-[3-chloro-4-(2-methylimidazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559648) has the molecular formula C16H15ClN4O3 and a molecular weight of 346.77 g/mol. Its IUPAC name is 3-[3-chloro-4-(2-methylimidazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-chloro-4-(2-methylimidazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559648 |
| Molecular Formula | C16H15ClN4O3 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[3-chloro-4-(2-methylimidazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | Cc1nccn1-c1ccc(NC2=CC(=O)N(CCO)C2=O)cc1Cl |
| InChI | InChI=1S/C16H15ClN4O3/c1-10-18-4-5-20(10)14-3-2-11(8-12(14)17)19-13-9-15(23)21(6-7-22)16(13)24/h2-5,8-9,19,22H,6-7H2,1H3 |
| InChIKey | UJDIPEZZKGTYNJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|