C14H13ClN2O5 — CID 168560083
6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzoic acid (PubChem CID 168560083) has the molecular formula C14H13ClN2O5 and a molecular weight of 324.72 g/mol. Its IUPAC name is 6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzoic acid.
| Compound Name | 6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 168560083 |
| Molecular Formula | C14H13ClN2O5 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzoic acid |
| SMILES | Cc1ccc(Cl)c(C(=O)O)c1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C14H13ClN2O5/c1-7-2-3-8(15)11(14(21)22)12(7)16-9-6-10(19)17(4-5-18)13(9)20/h2-3,6,16,18H,4-5H2,1H3,(H,21,22) |
| InChIKey | FNZUKBGWEDEJLV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|