C13H10Cl2N2O5 — CID 168557071
3,5-dichloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid (PubChem CID 168557071) has the molecular formula C13H10Cl2N2O5 and a molecular weight of 345.14 g/mol. Its IUPAC name is 3,5-dichloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid.
| Compound Name | 3,5-dichloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 168557071 |
| Molecular Formula | C13H10Cl2N2O5 |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 3,5-dichloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C13H10Cl2N2O5/c14-6-3-7(13(21)22)11(8(15)4-6)16-9-5-10(19)17(1-2-18)12(9)20/h3-5,16,18H,1-2H2,(H,21,22) |
| InChIKey | QEMFKGXEXOLDRN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|