C14H12BrClN2O5 — CID 168559957
methyl 3-bromo-5-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 168559957) has the molecular formula C14H12BrClN2O5 and a molecular weight of 403.62 g/mol. Its IUPAC name is methyl 3-bromo-5-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | methyl 3-bromo-5-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 168559957 |
| Molecular Formula | C14H12BrClN2O5 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | methyl 3-bromo-5-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)cc(Br)c1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C14H12BrClN2O5/c1-23-14(22)8-4-7(16)5-9(15)12(8)17-10-6-11(20)18(2-3-19)13(10)21/h4-6,17,19H,2-3H2,1H3 |
| InChIKey | YNTBWYBTGXTLTR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|