C14H11Br2ClN2O5 — CID 168556225
methyl 2,6-dibromo-4-chloro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 168556225) has the molecular formula C14H11Br2ClN2O5 and a molecular weight of 482.51 g/mol. Its IUPAC name is methyl 2,6-dibromo-4-chloro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | methyl 2,6-dibromo-4-chloro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 168556225 |
| Molecular Formula | C14H11Br2ClN2O5 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 479.87 |
| IUPAC Name | methyl 2,6-dibromo-4-chloro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | COC(=O)c1c(Br)cc(Cl)c(NC2=CC(=O)N(CCO)C2=O)c1Br |
| InChI | InChI=1S/C14H11Br2ClN2O5/c1-24-14(23)10-6(15)4-7(17)12(11(10)16)18-8-5-9(21)19(2-3-20)13(8)22/h4-5,18,20H,2-3H2,1H3 |
| InChIKey | AFKQAYXIDJOIEM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|