C21H19BrN2O6 — CID 168559553
methyl 3-bromo-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-phenylmethoxybenzoate (PubChem CID 168559553) has the molecular formula C21H19BrN2O6 and a molecular weight of 475.30 g/mol. Its IUPAC name is methyl 3-bromo-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-phenylmethoxybenzoate.
| Compound Name | methyl 3-bromo-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 168559553 |
| Molecular Formula | C21H19BrN2O6 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | methyl 3-bromo-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(Br)c(NC2=CC(=O)N(CCO)C2=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H19BrN2O6/c1-29-21(28)14-9-15(22)19(17(10-14)30-12-13-5-3-2-4-6-13)23-16-11-18(26)24(7-8-25)20(16)27/h2-6,9-11,23,25H,7-8,12H2,1H3 |
| InChIKey | WOCHBZQLQVGAEC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|