C13H10Br2N2O4 — CID 168557094
3,5-dibromo-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzaldehyde (PubChem CID 168557094) has the molecular formula C13H10Br2N2O4 and a molecular weight of 418.04 g/mol. Its IUPAC name is 3,5-dibromo-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzaldehyde.
| Compound Name | 3,5-dibromo-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 168557094 |
| Molecular Formula | C13H10Br2N2O4 |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 415.90 |
| IUPAC Name | 3,5-dibromo-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzaldehyde |
| SMILES | O=Cc1cc(Br)cc(Br)c1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C13H10Br2N2O4/c14-8-3-7(6-19)12(9(15)4-8)16-10-5-11(20)17(1-2-18)13(10)21/h3-6,16,18H,1-2H2 |
| InChIKey | AERZXMKLJOUICN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|