C13H10BrClN2O5 — CID 168558075
3-bromo-6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid (PubChem CID 168558075) has the molecular formula C13H10BrClN2O5 and a molecular weight of 389.59 g/mol. Its IUPAC name is 3-bromo-6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid.
| Compound Name | 3-bromo-6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 168558075 |
| Molecular Formula | C13H10BrClN2O5 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 3-bromo-6-chloro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Br)c1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C13H10BrClN2O5/c14-6-1-2-7(15)10(13(21)22)11(6)16-8-5-9(19)17(3-4-18)12(8)20/h1-2,5,16,18H,3-4H2,(H,21,22) |
| InChIKey | BNPMGBPJDVZRID-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|