C12H10ClN3O5 — CID 168556270
3-(2-chloro-6-nitroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556270) has the molecular formula C12H10ClN3O5 and a molecular weight of 311.68 g/mol. Its IUPAC name is 3-(2-chloro-6-nitroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2-chloro-6-nitroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556270 |
| Molecular Formula | C12H10ClN3O5 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 3-(2-chloro-6-nitroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2c(Cl)cccc2[N+](=O)[O-])C(=O)N1CCO |
| InChI | InChI=1S/C12H10ClN3O5/c13-7-2-1-3-9(16(20)21)11(7)14-8-6-10(18)15(4-5-17)12(8)19/h1-3,6,14,17H,4-5H2 |
| InChIKey | GWGDYSXCKVOJIP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|