C13H11BrN2O5 — CID 168560545
2-bromo-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid (PubChem CID 168560545) has the molecular formula C13H11BrN2O5 and a molecular weight of 355.14 g/mol. Its IUPAC name is 2-bromo-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid.
| Compound Name | 2-bromo-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 168560545 |
| Molecular Formula | C13H11BrN2O5 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2-bromo-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(NC2=CC(=O)N(CCO)C2=O)ccc1Br |
| InChI | InChI=1S/C13H11BrN2O5/c14-9-2-1-7(5-8(9)13(20)21)15-10-6-11(18)16(3-4-17)12(10)19/h1-2,5-6,15,17H,3-4H2,(H,20,21) |
| InChIKey | VTGOXHWHAGXOAP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|