C14H12N4O5 — CID 168560124
5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1H-indazole-7-carboxylic acid (PubChem CID 168560124) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1H-indazole-7-carboxylic acid.
| Compound Name | 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1H-indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 168560124 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1H-indazole-7-carboxylic acid |
| SMILES | O=C(O)c1cc(NC2=CC(=O)N(CCO)C2=O)cc2cn[nH]c12 |
| InChI | InChI=1S/C14H12N4O5/c19-2-1-18-11(20)5-10(13(18)21)16-8-3-7-6-15-17-12(7)9(4-8)14(22)23/h3-6,16,19H,1-2H2,(H,15,17)(H,22,23) |
| InChIKey | LTAOLEGKHHTRHN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|