C16H18N4O3 — CID 168557884
1-(2-hydroxyethyl)-3-[(1-propan-2-ylindazol-5-yl)amino]pyrrole-2,5-dione (PubChem CID 168557884) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(1-propan-2-ylindazol-5-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[(1-propan-2-ylindazol-5-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557884 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(1-propan-2-ylindazol-5-yl)amino]pyrrole-2,5-dione |
| SMILES | CC(C)n1ncc2cc(NC3=CC(=O)N(CCO)C3=O)ccc21 |
| InChI | InChI=1S/C16H18N4O3/c1-10(2)20-14-4-3-12(7-11(14)9-17-20)18-13-8-15(22)19(5-6-21)16(13)23/h3-4,7-10,18,21H,5-6H2,1-2H3 |
| InChIKey | QQTSGMHJHMKOKC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|