C18H21N3O6 — CID 168560486
5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(oxolan-2-ylmethylamino)benzoic acid (PubChem CID 168560486) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(oxolan-2-ylmethylamino)benzoic acid.
| Compound Name | 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(oxolan-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 168560486 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(oxolan-2-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC2=CC(=O)N(CCO)C2=O)ccc1NCC1CCCO1 |
| InChI | InChI=1S/C18H21N3O6/c22-6-5-21-16(23)9-15(17(21)24)20-11-3-4-14(13(8-11)18(25)26)19-10-12-2-1-7-27-12/h3-4,8-9,12,19-20,22H,1-2,5-7,10H2,(H,25,26) |
| InChIKey | MYIUPIUJAHUURR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|