C18H21N3O5 — CID 168559917
2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 168559917) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 168559917 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccccc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C18H21N3O5/c22-8-7-21-16(23)10-15(18(21)25)20-14-6-2-1-5-13(14)17(24)19-11-12-4-3-9-26-12/h1-2,5-6,10,12,20,22H,3-4,7-9,11H2,(H,19,24) |
| InChIKey | LAQWOSFMHKPQEJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|