C17H21N3O6S — CID 168558552
4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 168558552) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168558552 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C1C=C(Nc2ccc(S(=O)(=O)NCC3CCCO3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C17H21N3O6S/c21-8-7-20-16(22)10-15(17(20)23)19-12-3-5-14(6-4-12)27(24,25)18-11-13-2-1-9-26-13/h3-6,10,13,18-19,21H,1-2,7-9,11H2 |
| InChIKey | BMYWGPGZYJXJBC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|