C12H9BrClFN2O3 — CID 168557540
3-(4-bromo-3-chloro-2-fluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557540) has the molecular formula C12H9BrClFN2O3 and a molecular weight of 363.57 g/mol. Its IUPAC name is 3-(4-bromo-3-chloro-2-fluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-bromo-3-chloro-2-fluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557540 |
| Molecular Formula | C12H9BrClFN2O3 |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 3-(4-bromo-3-chloro-2-fluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(Br)c(Cl)c2F)C(=O)N1CCO |
| InChI | InChI=1S/C12H9BrClFN2O3/c13-6-1-2-7(11(15)10(6)14)16-8-5-9(19)17(3-4-18)12(8)20/h1-2,5,16,18H,3-4H2 |
| InChIKey | KKZXRYRIHWGUTO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|