C19H23ClN4O4 — CID 168559843
3-[3-chloro-4-(4-propanoylpiperazin-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559843) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is 3-[3-chloro-4-(4-propanoylpiperazin-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-chloro-4-(4-propanoylpiperazin-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559843 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-[3-chloro-4-(4-propanoylpiperazin-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CCC(=O)N1CCN(c2ccc(NC3=CC(=O)N(CCO)C3=O)cc2Cl)CC1 |
| InChI | InChI=1S/C19H23ClN4O4/c1-2-17(26)23-7-5-22(6-8-23)16-4-3-13(11-14(16)20)21-15-12-18(27)24(9-10-25)19(15)28/h3-4,11-12,21,25H,2,5-10H2,1H3 |
| InChIKey | QFSXVIILKMFJPQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|