C18H20BrFN4O4 — CID 168558894
3-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168558894) has the molecular formula C18H20BrFN4O4 and a molecular weight of 455.28 g/mol. Its IUPAC name is 3-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558894 |
| Molecular Formula | C18H20BrFN4O4 |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 3-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CC(=O)N1CCN(c2cc(Br)c(NC3=CC(=O)N(CCO)C3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H20BrFN4O4/c1-11(26)22-2-4-23(5-3-22)16-8-12(19)14(9-13(16)20)21-15-10-17(27)24(6-7-25)18(15)28/h8-10,21,25H,2-7H2,1H3 |
| InChIKey | IKJDIWZBQGEEPF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|