C16H18BrN3O4 — CID 168560328
3-(3-bromo-4-morpholin-4-ylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168560328) has the molecular formula C16H18BrN3O4 and a molecular weight of 396.24 g/mol. Its IUPAC name is 3-(3-bromo-4-morpholin-4-ylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(3-bromo-4-morpholin-4-ylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560328 |
| Molecular Formula | C16H18BrN3O4 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 3-(3-bromo-4-morpholin-4-ylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(N3CCOCC3)c(Br)c2)C(=O)N1CCO |
| InChI | InChI=1S/C16H18BrN3O4/c17-12-9-11(1-2-14(12)19-4-7-24-8-5-19)18-13-10-15(22)20(3-6-21)16(13)23/h1-2,9-10,18,21H,3-8H2 |
| InChIKey | LWJCGJFXVUKULT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|