C20H25N3O6 — CID 168559894
propyl 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-morpholin-4-ylbenzoate (PubChem CID 168559894) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is propyl 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-morpholin-4-ylbenzoate.
| Compound Name | propyl 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 168559894 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | propyl 5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-morpholin-4-ylbenzoate |
| SMILES | CCCOC(=O)c1cc(NC2=CC(=O)N(CCO)C2=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H25N3O6/c1-2-9-29-20(27)15-12-14(3-4-17(15)22-6-10-28-11-7-22)21-16-13-18(25)23(5-8-24)19(16)26/h3-4,12-13,21,24H,2,5-11H2,1H3 |
| InChIKey | IKLKZHAVGPIYSF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|