C17H18F3N3O4 — CID 168559809
1-(2-hydroxyethyl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)anilino]pyrrole-2,5-dione (PubChem CID 168559809) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559809 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(N3CCOCC3)cc2C(F)(F)F)C(=O)N1CCO |
| InChI | InChI=1S/C17H18F3N3O4/c18-17(19,20)12-9-11(22-4-7-27-8-5-22)1-2-13(12)21-14-10-15(25)23(3-6-24)16(14)26/h1-2,9-10,21,24H,3-8H2 |
| InChIKey | NHUCHLYSBDSGJL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|