C17H18N4O4S — CID 168557288
1-(2-hydroxyethyl)-3-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)amino]pyrrole-2,5-dione (PubChem CID 168557288) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557288 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)amino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc3nc(N4CCOCC4)sc3c2)C(=O)N1CCO |
| InChI | InChI=1S/C17H18N4O4S/c22-6-3-21-15(23)10-13(16(21)24)18-11-1-2-12-14(9-11)26-17(19-12)20-4-7-25-8-5-20/h1-2,9-10,18,22H,3-8H2 |
| InChIKey | QCVVHSPWFJTWEW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|