C14H12N6OS — CID 169341496
2-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile (PubChem CID 169341496) has the molecular formula C14H12N6OS and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169341496 |
| Molecular Formula | C14H12N6OS |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C14H12N6OS/c15-8-11(9-16)19-18-10-1-2-12-13(7-10)22-14(17-12)20-3-5-21-6-4-20/h1-2,7,18H,3-6H2 |
| InChIKey | YPTXITPZWQFFFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|