C17H19N3O2S — CID 74551313
N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hexa-2,4-dienamide (PubChem CID 74551313) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hexa-2,4-dienamide.
| Compound Name | N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 74551313 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)Nc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-2-3-4-5-16(21)18-13-6-7-14-15(12-13)23-17(19-14)20-8-10-22-11-9-20/h2-7,12H,8-11H2,1H3,(H,18,21) |
| InChIKey | XWWPVRWHUQFUPT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|