C13H11N5OS — CID 167211514
2-[(2-propan-2-yloxy-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile (PubChem CID 167211514) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-[(2-propan-2-yloxy-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(2-propan-2-yloxy-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 167211514 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(2-propan-2-yloxy-1,3-benzothiazol-6-yl)hydrazinylidene]propanedinitrile |
| SMILES | CC(C)Oc1nc2ccc(NN=C(C#N)C#N)cc2s1 |
| InChI | InChI=1S/C13H11N5OS/c1-8(2)19-13-16-11-4-3-9(5-12(11)20-13)17-18-10(6-14)7-15/h3-5,8,17H,1-2H3 |
| InChIKey | GDTAOIGVKFZFCZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|