C16H16BrN3O4 — CID 168559927
3-[(1-acetyl-7-bromo-2,3-dihydroindol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559927) has the molecular formula C16H16BrN3O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is 3-[(1-acetyl-7-bromo-2,3-dihydroindol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[(1-acetyl-7-bromo-2,3-dihydroindol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559927 |
| Molecular Formula | C16H16BrN3O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 3-[(1-acetyl-7-bromo-2,3-dihydroindol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CC(=O)N1CCc2cc(NC3=CC(=O)N(CCO)C3=O)cc(Br)c21 |
| InChI | InChI=1S/C16H16BrN3O4/c1-9(22)19-3-2-10-6-11(7-12(17)15(10)19)18-13-8-14(23)20(4-5-21)16(13)24/h6-8,18,21H,2-5H2,1H3 |
| InChIKey | VBNNDKOKNIXHCH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|