C19H17N3O4S — CID 168559702
1-(2-hydroxyethyl)-3-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]amino]pyrrole-2,5-dione (PubChem CID 168559702) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559702 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]amino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc3c(c2)N(C(=O)c2cccs2)CC3)C(=O)N1CCO |
| InChI | InChI=1S/C19H17N3O4S/c23-8-7-22-17(24)11-14(18(22)25)20-13-4-3-12-5-6-21(15(12)10-13)19(26)16-2-1-9-27-16/h1-4,9-11,20,23H,5-8H2 |
| InChIKey | RRGDBDCGWOQRAW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|