C19H21N3O3S — CID 110623601
1-(oxan-4-yl)-3-[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]urea (PubChem CID 110623601) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(oxan-4-yl)-3-[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]urea.
| Compound Name | 1-(oxan-4-yl)-3-[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]urea |
|---|---|
| PubChem CID | 110623601 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(oxan-4-yl)-3-[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)N(C(=O)c1cccs1)CC2)NC1CCOCC1 |
| InChI | InChI=1S/C19H21N3O3S/c23-18(17-2-1-11-26-17)22-8-5-13-3-4-15(12-16(13)22)21-19(24)20-14-6-9-25-10-7-14/h1-4,11-12,14H,5-10H2,(H2,20,21,24) |
| InChIKey | SCHDKKFPPVAFBC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |