C16H11N5OS — CID 169339335
2-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]hydrazinylidene]propanedinitrile (PubChem CID 169339335) has the molecular formula C16H11N5OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339335 |
| Molecular Formula | C16H11N5OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[[1-(thiophene-2-carbonyl)-2,3-dihydroindol-6-yl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc2c(c1)N(C(=O)c1cccs1)CC2 |
| InChI | InChI=1S/C16H11N5OS/c17-9-13(10-18)20-19-12-4-3-11-5-6-21(14(11)8-12)16(22)15-2-1-7-23-15/h1-4,7-8,19H,5-6H2 |
| InChIKey | XIFWQOWRUDDLLB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|