C18H17N3O4S — CID 168559630
N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylphenyl]thiophene-2-carboxamide (PubChem CID 168559630) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 168559630 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC2=CC(=O)N(CCO)C2=O)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C18H17N3O4S/c1-11-9-12(19-14-10-16(23)21(6-7-22)18(14)25)4-5-13(11)20-17(24)15-3-2-8-26-15/h2-5,8-10,19,22H,6-7H2,1H3,(H,20,24) |
| InChIKey | LJUYGJQKDUSLPL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|