C13H11ClF2N2O4 — CID 168560638
3-[5-chloro-2-(difluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168560638) has the molecular formula C13H11ClF2N2O4 and a molecular weight of 332.69 g/mol. Its IUPAC name is 3-[5-chloro-2-(difluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[5-chloro-2-(difluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560638 |
| Molecular Formula | C13H11ClF2N2O4 |
| Molecular Weight | 332.69 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-[5-chloro-2-(difluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(Cl)ccc2OC(F)F)C(=O)N1CCO |
| InChI | InChI=1S/C13H11ClF2N2O4/c14-7-1-2-10(22-13(15)16)8(5-7)17-9-6-11(20)18(3-4-19)12(9)21/h1-2,5-6,13,17,19H,3-4H2 |
| InChIKey | ZEQPFOFSOFYMEU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.69 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|