C19H12F6N2O4 — CID 168557169
3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557169) has the molecular formula C19H12F6N2O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is 3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557169 |
| Molecular Formula | C19H12F6N2O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(F)cc2Oc2c(F)cc(C(F)(F)F)cc2F)C(=O)N1CCO |
| InChI | InChI=1S/C19H12F6N2O4/c20-10-1-2-13(26-14-8-16(29)27(3-4-28)18(14)30)15(7-10)31-17-11(21)5-9(6-12(17)22)19(23,24)25/h1-2,5-8,26,28H,3-4H2 |
| InChIKey | RVVCGFQFAPBHFB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|