C15H15FN2O6 — CID 168557897
methyl 3-fluoro-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-methoxybenzoate (PubChem CID 168557897) has the molecular formula C15H15FN2O6 and a molecular weight of 338.29 g/mol. Its IUPAC name is methyl 3-fluoro-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-methoxybenzoate.
| Compound Name | methyl 3-fluoro-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 168557897 |
| Molecular Formula | C15H15FN2O6 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 3-fluoro-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(F)c(OC)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C15H15FN2O6/c1-23-13-9(16)5-8(15(22)24-2)6-10(13)17-11-7-12(20)18(3-4-19)14(11)21/h5-7,17,19H,3-4H2,1-2H3 |
| InChIKey | PCQRWVPWVCSEKH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|