C15H17N3O6 — CID 168558384
2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4,5-dimethoxybenzamide (PubChem CID 168558384) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4,5-dimethoxybenzamide.
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 168558384 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(NC2=CC(=O)N(CCO)C2=O)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C15H17N3O6/c1-23-11-5-8(14(16)21)9(6-12(11)24-2)17-10-7-13(20)18(3-4-19)15(10)22/h5-7,17,19H,3-4H2,1-2H3,(H2,16,21) |
| InChIKey | LFWDDBFVWSXCRV-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|