C14H14FN3O4 — CID 168559659
4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzamide (PubChem CID 168559659) has the molecular formula C14H14FN3O4 and a molecular weight of 307.28 g/mol. Its IUPAC name is 4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzamide.
| Compound Name | 4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 168559659 |
| Molecular Formula | C14H14FN3O4 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(F)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C14H14FN3O4/c1-16-13(21)8-2-3-9(15)10(6-8)17-11-7-12(20)18(4-5-19)14(11)22/h2-3,6-7,17,19H,4-5H2,1H3,(H,16,21) |
| InChIKey | DCIPIAQEXIUXDC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|