C19H12BrF5N2O4 — CID 168557150
3-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557150) has the molecular formula C19H12BrF5N2O4 and a molecular weight of 507.21 g/mol. Its IUPAC name is 3-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557150 |
| Molecular Formula | C19H12BrF5N2O4 |
| Molecular Weight | 507.21 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 3-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(Oc3c(F)cc(C(F)(F)F)cc3F)ccc2Br)C(=O)N1CCO |
| InChI | InChI=1S/C19H12BrF5N2O4/c20-11-2-1-10(31-17-12(21)5-9(6-13(17)22)19(23,24)25)7-14(11)26-15-8-16(29)27(3-4-28)18(15)30/h1-2,5-8,26,28H,3-4H2 |
| InChIKey | IOJLZNWAFATUFA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|