C19H15N3O4 — CID 168558838
3-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]benzonitrile (PubChem CID 168558838) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]benzonitrile.
| Compound Name | 3-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 168558838 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2ccccc2NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C19H15N3O4/c20-12-13-4-3-5-14(10-13)26-17-7-2-1-6-15(17)21-16-11-18(24)22(8-9-23)19(16)25/h1-7,10-11,21,23H,8-9H2 |
| InChIKey | XWADTHKSZVVIIT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|