C25H21N3O5 — CID 168560288
4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-phenoxyphenyl)benzamide (PubChem CID 168560288) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-phenoxyphenyl)benzamide.
| Compound Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 168560288 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)c1ccc(NC2=CC(=O)N(CCO)C2=O)cc1 |
| InChI | InChI=1S/C25H21N3O5/c29-15-14-28-23(30)16-21(25(28)32)26-18-12-10-17(11-13-18)24(31)27-20-8-4-5-9-22(20)33-19-6-2-1-3-7-19/h1-13,16,26,29H,14-15H2,(H,27,31) |
| InChIKey | JFJQGWLJISEMFM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|