C13H9ClIN3O3 — CID 168557711
2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodobenzonitrile (PubChem CID 168557711) has the molecular formula C13H9ClIN3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodobenzonitrile.
| Compound Name | 2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodobenzonitrile |
|---|---|
| PubChem CID | 168557711 |
| Molecular Formula | C13H9ClIN3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | 2-chloro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodobenzonitrile |
| SMILES | N#Cc1cc(I)c(NC2=CC(=O)N(CCO)C2=O)cc1Cl |
| InChI | InChI=1S/C13H9ClIN3O3/c14-8-4-10(9(15)3-7(8)6-16)17-11-5-12(20)18(1-2-19)13(11)21/h3-5,17,19H,1-2H2 |
| InChIKey | VWISGZLHQZHQBT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|