C19H23N3O4 — CID 168560760
1-(2-hydroxyethyl)-3-[2-(4-methylpiperidine-1-carbonyl)anilino]pyrrole-2,5-dione (PubChem CID 168560760) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[2-(4-methylpiperidine-1-carbonyl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[2-(4-methylpiperidine-1-carbonyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560760 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[2-(4-methylpiperidine-1-carbonyl)anilino]pyrrole-2,5-dione |
| SMILES | CC1CCN(C(=O)c2ccccc2NC2=CC(=O)N(CCO)C2=O)CC1 |
| InChI | InChI=1S/C19H23N3O4/c1-13-6-8-21(9-7-13)18(25)14-4-2-3-5-15(14)20-16-12-17(24)22(10-11-23)19(16)26/h2-5,12-13,20,23H,6-11H2,1H3 |
| InChIKey | UZROMOHNGWJULM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|