C12H8BrF2IN2O3 — CID 168558956
3-(4-bromo-3,5-difluoro-2-iodoanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168558956) has the molecular formula C12H8BrF2IN2O3 and a molecular weight of 473.01 g/mol. Its IUPAC name is 3-(4-bromo-3,5-difluoro-2-iodoanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-bromo-3,5-difluoro-2-iodoanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558956 |
| Molecular Formula | C12H8BrF2IN2O3 |
| Molecular Weight | 473.01 g/mol |
| Exact Mass | 471.87 |
| IUPAC Name | 3-(4-bromo-3,5-difluoro-2-iodoanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(F)c(Br)c(F)c2I)C(=O)N1CCO |
| InChI | InChI=1S/C12H8BrF2IN2O3/c13-9-5(14)3-6(11(16)10(9)15)17-7-4-8(20)18(1-2-19)12(7)21/h3-4,17,19H,1-2H2 |
| InChIKey | CZWXZVOACXCTAL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.01 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|