C16H16N4O3 — CID 168559816
1-(2-hydroxyethyl)-3-(4-imidazol-1-yl-2-methylanilino)pyrrole-2,5-dione (PubChem CID 168559816) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(4-imidazol-1-yl-2-methylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(4-imidazol-1-yl-2-methylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559816 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(4-imidazol-1-yl-2-methylanilino)pyrrole-2,5-dione |
| SMILES | Cc1cc(-n2ccnc2)ccc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C16H16N4O3/c1-11-8-12(19-5-4-17-10-19)2-3-13(11)18-14-9-15(22)20(6-7-21)16(14)23/h2-5,8-10,18,21H,6-7H2,1H3 |
| InChIKey | FCHJAWLCJNOQSG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|