C16H15N5O5 — CID 168557985
2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methyl-5-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 168557985) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methyl-5-(1,2,4-triazol-1-yl)benzoic acid.
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methyl-5-(1,2,4-triazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168557985 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methyl-5-(1,2,4-triazol-1-yl)benzoic acid |
| SMILES | Cc1cc(-n2cncn2)cc(C(=O)O)c1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C16H15N5O5/c1-9-4-10(21-8-17-7-18-21)5-11(16(25)26)14(9)19-12-6-13(23)20(2-3-22)15(12)24/h4-8,19,22H,2-3H2,1H3,(H,25,26) |
| InChIKey | MDBWOAHCGWJIST-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|