C23H26N6O3 — CID 168558631
3-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168558631) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558631 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC4=CC(=O)N(CCO)C4=O)cc3n2)cc1 |
| InChI | InChI=1S/C23H26N6O3/c1-4-27(5-2)16-6-8-17(9-7-16)29-25-19-12-15(3)18(13-20(19)26-29)24-21-14-22(31)28(10-11-30)23(21)32/h6-9,12-14,24,30H,4-5,10-11H2,1-3H3 |
| InChIKey | JVVFULGSGKVOPX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|