C30H29N5O — CID 23097353
N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-4-phenylbenzamide (PubChem CID 23097353) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-4-phenylbenzamide.
| Compound Name | N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 23097353 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-4-phenylbenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4ccc(-c5ccccc5)cc4)cc3n2)cc1 |
| InChI | InChI=1S/C30H29N5O/c1-4-34(5-2)25-15-17-26(18-16-25)35-32-28-19-21(3)27(20-29(28)33-35)31-30(36)24-13-11-23(12-14-24)22-9-7-6-8-10-22/h6-20H,4-5H2,1-3H3,(H,31,36) |
| InChIKey | DHEBOSIEEOYZHI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|