C16H13N3O5 — CID 168557937
8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]quinoline-2-carboxylic acid (PubChem CID 168557937) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is 8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]quinoline-2-carboxylic acid.
| Compound Name | 8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 168557937 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cccc(NC3=CC(=O)N(CCO)C3=O)c2n1 |
| InChI | InChI=1S/C16H13N3O5/c20-7-6-19-13(21)8-12(15(19)22)17-10-3-1-2-9-4-5-11(16(23)24)18-14(9)10/h1-5,8,17,20H,6-7H2,(H,23,24) |
| InChIKey | SDBWZAVGYFRYGU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|