C16H14N6O2 — CID 168603417
1-(diaminomethylidene)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]guanidine (PubChem CID 168603417) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168603417 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C16H14N6O2/c17-15(18)21-16(19)20-9-5-7-10(8-6-9)22-13(23)11-3-1-2-4-12(11)14(22)24/h1-8H,(H6,17,18,19,20,21) |
| InChIKey | SFYRLSCOWGIISU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|