C18H16N6O4 — CID 168601878
methyl 4-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 168601878) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is methyl 4-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 168601878 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | methyl 4-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)c3ccc(/N=C(\N)N=C(N)N)cc3C2=O)cc1 |
| InChI | InChI=1S/C18H16N6O4/c1-28-16(27)9-2-5-11(6-3-9)24-14(25)12-7-4-10(8-13(12)15(24)26)22-18(21)23-17(19)20/h2-8H,1H3,(H6,19,20,21,22,23) |
| InChIKey | WBUDYMXBSZYRDJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 166.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|